C12H12O2 — CID 89001757
1-(3a,7a-Dihydro-1-benzofuran-2-yl)-2-methylprop-2-en-1-one (PubChem CID 89001757) has the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(3a,7a-Dihydro-1-benzofuran-2-yl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 89001757 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-(3a,7a-dihydro-1-benzofuran-2-yl)-2-methylprop-2-en-1-one |
| SMILES | CC(=C)C(=O)C1=CC2C=CC=CC2O1 |
| InChI | InChI=1S/C12H12O2/c1-8(2)12(13)11-7-9-5-3-4-6-10(9)14-11/h3-7,9-10H,1H2,2H3 |
| InChIKey | CVTHMPKVCHKBEO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 372 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|