C20H27CrO2 — CID 89002237
[(3R,10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methylidynechromium (PubChem CID 89002237) has the molecular formula C20H27CrO2 and a molecular weight of 351.43 g/mol. Its IUPAC name is [(3R,10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methylidynechromium.
| Compound Name | [(3R,10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methylidynechromium |
|---|---|
| PubChem CID | 89002237 |
| Molecular Formula | C20H27CrO2 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [(3R,10R,13S,17S)-3,17-dihydroxy-10,13-dimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]methylidynechromium |
| SMILES | C[C@]12C=C[C@H](O)CC1CC=C1C2CC[C@@]2(C)C1CC[C@@]2(O)C#[Cr] |
| InChI | InChI=1S/C20H27O2.Cr/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22;/h5-6,9,13-14,16-17,21-22H,4,7-8,10-12H2,1-2H3;/t13?,14-,16?,17?,18-,19-,20-;/m0./s1 |
| InChIKey | MEFFUOQBUFHLIL-BASWHVRCSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|