C20H30O — CID 142950810
(10R,13R,17S)-10,13,17-trimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142950810) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (10R,13R,17S)-10,13,17-trimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,13R,17S)-10,13,17-trimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142950810 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (10R,13R,17S)-10,13,17-trimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H]1CCC2C3=CCC4CC(O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C20H30O/c1-13-4-7-17-16-6-5-14-12-15(21)8-10-20(14,3)18(16)9-11-19(13,17)2/h6,8,10,13-15,17-18,21H,4-5,7,9,11-12H2,1-3H3/t13-,14?,15?,17?,18?,19+,20-/m0/s1 |
| InChIKey | PYVUNQVBTRMLEC-YREMYEGXSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|