C24H26N2O6S2 — CID 89005127
3-ethyl-4-[[4-[4-[(3-ethylperoxy-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 89005127) has the molecular formula C24H26N2O6S2 and a molecular weight of 502.61 g/mol. Its IUPAC name is 3-ethyl-4-[[4-[4-[(3-ethylperoxy-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-ethyl-4-[[4-[4-[(3-ethylperoxy-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89005127 |
| Molecular Formula | C24H26N2O6S2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 3-ethyl-4-[[4-[4-[(3-ethylperoxy-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CCOON1C(=O)C(Cc2ccc(Oc3ccc(CC4COC(=O)N4CC)cc3)cc2)SC1=S |
| InChI | InChI=1S/C24H26N2O6S2/c1-3-25-18(15-29-23(25)28)13-16-5-9-19(10-6-16)31-20-11-7-17(8-12-20)14-21-22(27)26(24(33)34-21)32-30-4-2/h5-12,18,21H,3-4,13-15H2,1-2H3 |
| InChIKey | FZAUUZYKZOICQS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|