C23H21F3N2O4S2 — CID 143307700
(E)-3-[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]-N-methanethioyl-2-sulfanylprop-2-enamide (PubChem CID 143307700) has the molecular formula C23H21F3N2O4S2 and a molecular weight of 510.56 g/mol. Its IUPAC name is (E)-3-[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]-N-methanethioyl-2-sulfanylprop-2-enamide.
| Compound Name | (E)-3-[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]-N-methanethioyl-2-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 143307700 |
| Molecular Formula | C23H21F3N2O4S2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (E)-3-[4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]-3-(trifluoromethyl)phenyl]-N-methanethioyl-2-sulfanylprop-2-enamide |
| SMILES | CCN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C(/S)C(=O)NC=S)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N2O4S2/c1-2-28-16(12-31-22(28)30)9-14-3-6-17(7-4-14)32-19-8-5-15(10-18(19)23(24,25)26)11-20(34)21(29)27-13-33/h3-8,10-11,13,16,34H,2,9,12H2,1H3,(H,27,29,33)/b20-11+ |
| InChIKey | DMLOANQJFWLLOA-RGVLZGJSSA-N |
| XLogP | 5.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|