C25H34O3 — CID 89007869
[2-methyl-4-[[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]methyl]phenyl] 2-methylpropanoate (PubChem CID 89007869) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is [2-methyl-4-[[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]methyl]phenyl] 2-methylpropanoate.
| Compound Name | [2-methyl-4-[[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]methyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 89007869 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [2-methyl-4-[[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]methyl]phenyl] 2-methylpropanoate |
| SMILES | CCC(C)(CC)Oc1ccc(Cc2ccc(OC(=O)C(C)C)c(C)c2)cc1C |
| InChI | InChI=1S/C25H34O3/c1-8-25(7,9-2)28-23-13-11-21(15-19(23)6)16-20-10-12-22(18(5)14-20)27-24(26)17(3)4/h10-15,17H,8-9,16H2,1-7H3 |
| InChIKey | BDEPFYODYTUKJR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|