C39H46O4 — CID 139319727
[2-methyl-4-[1-[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 4-(4-butan-2-ylphenoxy)benzoate (PubChem CID 139319727) has the molecular formula C39H46O4 and a molecular weight of 578.79 g/mol. Its IUPAC name is [2-methyl-4-[1-[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 4-(4-butan-2-ylphenoxy)benzoate.
| Compound Name | [2-methyl-4-[1-[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 4-(4-butan-2-ylphenoxy)benzoate |
|---|---|
| PubChem CID | 139319727 |
| Molecular Formula | C39H46O4 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [2-methyl-4-[1-[3-methyl-4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 4-(4-butan-2-ylphenoxy)benzoate |
| SMILES | CCC(C)c1ccc(Oc2ccc(C(=O)Oc3ccc(C(C)c4ccc(OC(C)(CC)CC)c(C)c4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C39H46O4/c1-9-26(4)30-12-18-34(19-13-30)41-35-20-14-31(15-21-35)38(40)42-36-22-16-32(24-27(36)5)29(7)33-17-23-37(28(6)25-33)43-39(8,10-2)11-3/h12-26,29H,9-11H2,1-8H3 |
| InChIKey | QCKFRJDTELVPME-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|