C34H36F6O4 — CID 89190420
1-O-[4-[2-(4-butan-2-yl-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 4-O-(2-methylbutan-2-yl) benzene-1,4-dicarboxylate (PubChem CID 89190420) has the molecular formula C34H36F6O4 and a molecular weight of 622.65 g/mol. Its IUPAC name is 1-O-[4-[2-(4-butan-2-yl-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 4-O-(2-methylbutan-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-[2-(4-butan-2-yl-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 4-O-(2-methylbutan-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89190420 |
| Molecular Formula | C34H36F6O4 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 1-O-[4-[2-(4-butan-2-yl-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylphenyl] 4-O-(2-methylbutan-2-yl) benzene-1,4-dicarboxylate |
| SMILES | CCC(C)c1ccc(C(c2ccc(OC(=O)c3ccc(C(=O)OC(C)(C)CC)cc3)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C34H36F6O4/c1-8-20(3)27-16-14-25(18-21(27)4)32(33(35,36)37,34(38,39)40)26-15-17-28(22(5)19-26)43-29(41)23-10-12-24(13-11-23)30(42)44-31(6,7)9-2/h10-20H,8-9H2,1-7H3 |
| InChIKey | NBTBRAFAZIJIBO-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|