C37H44O4 — CID 89190455
1-O-[4-[[4-butan-2-yl-3-[(Z)-but-2-enyl]phenyl]methyl]-2-prop-2-enylphenyl] 3-O-(2-methylbutan-2-yl) benzene-1,3-dicarboxylate (PubChem CID 89190455) has the molecular formula C37H44O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is 1-O-[4-[[4-butan-2-yl-3-[(Z)-but-2-enyl]phenyl]methyl]-2-prop-2-enylphenyl] 3-O-(2-methylbutan-2-yl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-[4-[[4-butan-2-yl-3-[(Z)-but-2-enyl]phenyl]methyl]-2-prop-2-enylphenyl] 3-O-(2-methylbutan-2-yl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 89190455 |
| Molecular Formula | C37H44O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-O-[4-[[4-butan-2-yl-3-[(Z)-but-2-enyl]phenyl]methyl]-2-prop-2-enylphenyl] 3-O-(2-methylbutan-2-yl) benzene-1,3-dicarboxylate |
| SMILES | C=CCc1cc(Cc2ccc(C(C)CC)c(C/C=C\C)c2)ccc1OC(=O)c1cccc(C(=O)OC(C)(C)CC)c1 |
| InChI | InChI=1S/C37H44O4/c1-8-12-15-29-23-27(18-20-33(29)26(5)10-3)22-28-19-21-34(30(24-28)14-9-2)40-35(38)31-16-13-17-32(25-31)36(39)41-37(6,7)11-4/h8-9,12-13,16-21,23-26H,2,10-11,14-15,22H2,1,3-7H3/b12-8- |
| InChIKey | JYMKNJQLCIVAGZ-WQLSENKSSA-N |
| XLogP | 9.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|