C37H34F6O4 — CID 89190479
[4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-(4-butan-2-yloxycarbonylphenyl)benzoate (PubChem CID 89190479) has the molecular formula C37H34F6O4 and a molecular weight of 656.66 g/mol. Its IUPAC name is [4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-(4-butan-2-yloxycarbonylphenyl)benzoate.
| Compound Name | [4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-(4-butan-2-yloxycarbonylphenyl)benzoate |
|---|---|
| PubChem CID | 89190479 |
| Molecular Formula | C37H34F6O4 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | [4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-(4-butan-2-yloxycarbonylphenyl)benzoate |
| SMILES | CCC(C)OC(=O)c1ccc(-c2ccc(C(=O)Oc3ccc(C(c4ccc(C(C)(C)C)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H34F6O4/c1-6-23(2)46-32(44)26-11-7-24(8-12-26)25-9-13-27(14-10-25)33(45)47-31-21-19-30(20-22-31)35(36(38,39)40,37(41,42)43)29-17-15-28(16-18-29)34(3,4)5/h7-23H,6H2,1-5H3 |
| InChIKey | WGYGXBFUIQJGAX-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|