C38H42O3 — CID 66810086
[2-methyl-4-[9-[3-methyl-4-(3-methylhexan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-methylpropanoate (PubChem CID 66810086) has the molecular formula C38H42O3 and a molecular weight of 546.75 g/mol. Its IUPAC name is [2-methyl-4-[9-[3-methyl-4-(3-methylhexan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-methylpropanoate.
| Compound Name | [2-methyl-4-[9-[3-methyl-4-(3-methylhexan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 66810086 |
| Molecular Formula | C38H42O3 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | [2-methyl-4-[9-[3-methyl-4-(3-methylhexan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-methylpropanoate |
| SMILES | CCCC(C)(CC)Oc1ccc(C2(c3ccc(OC(=O)C(C)C)c(C)c3)c3ccccc3-c3ccccc32)cc1C |
| InChI | InChI=1S/C38H42O3/c1-8-22-37(7,9-2)41-35-21-19-29(24-27(35)6)38(28-18-20-34(26(5)23-28)40-36(39)25(3)4)32-16-12-10-14-30(32)31-15-11-13-17-33(31)38/h10-21,23-25H,8-9,22H2,1-7H3 |
| InChIKey | WWTYVDFWOCCUBQ-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|