C46H58O3 — CID 89359515
[2-methyl-4-[9-[3-methyl-4-(3-methyloctan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-ethyl-2-methylheptanoate (PubChem CID 89359515) has the molecular formula C46H58O3 and a molecular weight of 658.97 g/mol. Its IUPAC name is [2-methyl-4-[9-[3-methyl-4-(3-methyloctan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-ethyl-2-methylheptanoate.
| Compound Name | [2-methyl-4-[9-[3-methyl-4-(3-methyloctan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-ethyl-2-methylheptanoate |
|---|---|
| PubChem CID | 89359515 |
| Molecular Formula | C46H58O3 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.44 |
| IUPAC Name | [2-methyl-4-[9-[3-methyl-4-(3-methyloctan-3-yloxy)phenyl]fluoren-9-yl]phenyl] 2-ethyl-2-methylheptanoate |
| SMILES | CCCCCC(C)(CC)Oc1ccc(C2(c3ccc(OC(=O)C(C)(CC)CCCCC)c(C)c3)c3ccccc3-c3ccccc32)cc1C |
| InChI | InChI=1S/C46H58O3/c1-9-13-19-29-44(7,11-3)43(47)48-41-27-25-35(31-33(41)5)46(39-23-17-15-21-37(39)38-22-16-18-24-40(38)46)36-26-28-42(34(6)32-36)49-45(8,12-4)30-20-14-10-2/h15-18,21-28,31-32H,9-14,19-20,29-30H2,1-8H3 |
| InChIKey | BPTWHFCGFHRMMO-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|