C18H17N — CID 89011287
9-[(2Z,4Z)-hexa-2,4-dienyl]carbazole (PubChem CID 89011287) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 9-[(2Z,4Z)-hexa-2,4-dienyl]carbazole.
| Compound Name | 9-[(2Z,4Z)-hexa-2,4-dienyl]carbazole |
|---|---|
| PubChem CID | 89011287 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 9-[(2Z,4Z)-hexa-2,4-dienyl]carbazole |
| SMILES | C/C=C\C=C/Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C18H17N/c1-2-3-4-9-14-19-17-12-7-5-10-15(17)16-11-6-8-13-18(16)19/h2-13H,14H2,1H3/b3-2-,9-4- |
| InChIKey | WNBQCRWFICNGOU-UARZHTBLSA-N |
| XLogP | 4.93 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|