C27H22F3N5O5 — CID 89012755
3-benzyl-N-[[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-(trifluoromethoxy)phenyl]methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 89012755) has the molecular formula C27H22F3N5O5 and a molecular weight of 553.50 g/mol. Its IUPAC name is 3-benzyl-N-[[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-(trifluoromethoxy)phenyl]methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 3-benzyl-N-[[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-(trifluoromethoxy)phenyl]methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 89012755 |
| Molecular Formula | C27H22F3N5O5 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 3-benzyl-N-[[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-(trifluoromethoxy)phenyl]methyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | N/C(=N/O)c1ccc(-c2ccc(CNC(=O)c3cc(=O)n(Cc4ccccc4)c(=O)[nH]3)c(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H22F3N5O5/c28-27(29,30)40-22-12-19(17-6-8-18(9-7-17)24(31)34-39)10-11-20(22)14-32-25(37)21-13-23(36)35(26(38)33-21)15-16-4-2-1-3-5-16/h1-13,39H,14-15H2,(H2,31,34)(H,32,37)(H,33,38) |
| InChIKey | JSSFGLXIIJAPBU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|