C13H14BrN3OS — CID 89014643
(E)-N-(4-bromo-2-pyridin-3-yl-4,5-dihydro-1,3-thiazol-5-yl)-N-methylbut-2-enamide (PubChem CID 89014643) has the molecular formula C13H14BrN3OS and a molecular weight of 340.25 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-pyridin-3-yl-4,5-dihydro-1,3-thiazol-5-yl)-N-methylbut-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-pyridin-3-yl-4,5-dihydro-1,3-thiazol-5-yl)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 89014643 |
| Molecular Formula | C13H14BrN3OS |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | (E)-N-(4-bromo-2-pyridin-3-yl-4,5-dihydro-1,3-thiazol-5-yl)-N-methylbut-2-enamide |
| SMILES | C/C=C/C(=O)N(C)C1SC(c2cccnc2)=NC1Br |
| InChI | InChI=1S/C13H14BrN3OS/c1-3-5-10(18)17(2)13-11(14)16-12(19-13)9-6-4-7-15-8-9/h3-8,11,13H,1-2H3/b5-3+ |
| InChIKey | OBNRQEGQKCEKJU-HWKANZROSA-N |
| XLogP | 2.66 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|