C21H32N2O3 — CID 89016974
benzyl N-[(3S)-2-[[(3S)-2-methoxy-4-methylpent-1-en-3-yl]amino]-4-methylpent-1-en-3-yl]carbamate (PubChem CID 89016974) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is benzyl N-[(3S)-2-[[(3S)-2-methoxy-4-methylpent-1-en-3-yl]amino]-4-methylpent-1-en-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-2-[[(3S)-2-methoxy-4-methylpent-1-en-3-yl]amino]-4-methylpent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 89016974 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | benzyl N-[(3S)-2-[[(3S)-2-methoxy-4-methylpent-1-en-3-yl]amino]-4-methylpent-1-en-3-yl]carbamate |
| SMILES | C=C(N[C@H](C(=C)OC)C(C)C)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H32N2O3/c1-14(2)19(16(5)22-20(15(3)4)17(6)25-7)23-21(24)26-13-18-11-9-8-10-12-18/h8-12,14-15,19-20,22H,5-6,13H2,1-4,7H3,(H,23,24)/t19-,20-/m0/s1 |
| InChIKey | PVCVUZIHRJDGFJ-PMACEKPBSA-N |
| XLogP | 4.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|