C55H68N2 — CID 89017172
2-N,7-N-bis(4,4a,5,6-tetrahydronaphthalen-1-yl)-2-N,7-N-bis(4-tert-butylcyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine (PubChem CID 89017172) has the molecular formula C55H68N2 and a molecular weight of 757.16 g/mol. Its IUPAC name is 2-N,7-N-bis(4,4a,5,6-tetrahydronaphthalen-1-yl)-2-N,7-N-bis(4-tert-butylcyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4,4a,5,6-tetrahydronaphthalen-1-yl)-2-N,7-N-bis(4-tert-butylcyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 89017172 |
| Molecular Formula | C55H68N2 |
| Molecular Weight | 757.16 g/mol |
| Exact Mass | 756.54 |
| IUPAC Name | 2-N,7-N-bis(4,4a,5,6-tetrahydronaphthalen-1-yl)-2-N,7-N-bis(4-tert-butylcyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
| SMILES | CC(C)(C)C1=CCC(N(C2=CC3=C(CC2)C2=CC=C(N(C4=C5C=CCCC5CC=C4)C4C=CC(C(C)(C)C)=CC4)CC2C3(C)C)C2=C3C=CCCC3CC=C2)C=C1 |
| InChI | InChI=1S/C55H68N2/c1-53(2,3)39-23-27-41(28-24-39)56(51-21-13-17-37-15-9-11-19-45(37)51)43-31-33-47-48-34-32-44(36-50(48)55(7,8)49(47)35-43)57(42-29-25-40(26-30-42)54(4,5)6)52-22-14-18-38-16-10-12-20-46(38)52/h11-14,19-27,29,31,33,36-38,41-42,49H,9-10,15-18,28,30,32,34-35H2,1-8H3 |
| InChIKey | SOBJZWRSQABUQD-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.16 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |