C20H17BrF2O5 — CID 89021058
phenyl 2-(1-bromo-2,2-difluoroethenyl)-6-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (PubChem CID 89021058) has the molecular formula C20H17BrF2O5 and a molecular weight of 455.25 g/mol. Its IUPAC name is phenyl 2-(1-bromo-2,2-difluoroethenyl)-6-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate.
| Compound Name | phenyl 2-(1-bromo-2,2-difluoroethenyl)-6-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
|---|---|
| PubChem CID | 89021058 |
| Molecular Formula | C20H17BrF2O5 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | phenyl 2-(1-bromo-2,2-difluoroethenyl)-6-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(C(Br)=C(F)F)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H17BrF2O5/c1-20(2,3)28-19(25)27-14-11-7-10-13(16(21)17(22)23)15(14)18(24)26-12-8-5-4-6-9-12/h4-11H,1-3H3 |
| InChIKey | SEEDROWLNJLKGI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|