C33H45FN4O4 — CID 89023324
2-[4-[3-tert-butyl-5-[4-(2-ethanimidoyl-4,5-diethoxy-3-fluorophenyl)butanoyl]-2-methoxyphenyl]piperazin-1-yl]acetonitrile (PubChem CID 89023324) has the molecular formula C33H45FN4O4 and a molecular weight of 580.75 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-[4-(2-ethanimidoyl-4,5-diethoxy-3-fluorophenyl)butanoyl]-2-methoxyphenyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-[3-tert-butyl-5-[4-(2-ethanimidoyl-4,5-diethoxy-3-fluorophenyl)butanoyl]-2-methoxyphenyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 89023324 |
| Molecular Formula | C33H45FN4O4 |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-[4-(2-ethanimidoyl-4,5-diethoxy-3-fluorophenyl)butanoyl]-2-methoxyphenyl]piperazin-1-yl]acetonitrile |
| SMILES | [H]/N=C(\C)c1c(CCCC(=O)c2cc(N3CCN(CC#N)CC3)c(OC)c(C(C)(C)C)c2)cc(OCC)c(OCC)c1F |
| InChI | InChI=1S/C33H45FN4O4/c1-8-41-28-21-23(29(22(3)36)30(34)32(28)42-9-2)11-10-12-27(39)24-19-25(33(4,5)6)31(40-7)26(20-24)38-17-15-37(14-13-35)16-18-38/h19-21,36H,8-12,14-18H2,1-7H3/b36-22+ |
| InChIKey | OXWNRRQDKZYWTA-HPNXWYHWSA-N |
| XLogP | 6.17 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|