C14H20FNO2 — CID 143227173
1-(3,4-diethoxy-6-ethyl-2-fluorophenyl)ethanimine (PubChem CID 143227173) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-(3,4-diethoxy-6-ethyl-2-fluorophenyl)ethanimine.
| Compound Name | 1-(3,4-diethoxy-6-ethyl-2-fluorophenyl)ethanimine |
|---|---|
| PubChem CID | 143227173 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(3,4-diethoxy-6-ethyl-2-fluorophenyl)ethanimine |
| SMILES | [H]/N=C(\C)c1c(CC)cc(OCC)c(OCC)c1F |
| InChI | InChI=1S/C14H20FNO2/c1-5-10-8-11(17-6-2)14(18-7-3)13(15)12(10)9(4)16/h8,16H,5-7H2,1-4H3/b16-9+ |
| InChIKey | ANROUMGTEBUQQK-CXUHLZMHSA-N |
| XLogP | 3.57 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|