C13H9ClF3NOS — CID 89024193
3-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]prop-1-en-2-ol (PubChem CID 89024193) has the molecular formula C13H9ClF3NOS and a molecular weight of 319.74 g/mol. Its IUPAC name is 3-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]prop-1-en-2-ol.
| Compound Name | 3-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 89024193 |
| Molecular Formula | C13H9ClF3NOS |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 3-[2-[4-chloro-3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]prop-1-en-2-ol |
| SMILES | C=C(O)Cc1csc(-c2ccc(Cl)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H9ClF3NOS/c1-7(19)4-9-6-20-12(18-9)8-2-3-11(14)10(5-8)13(15,16)17/h2-3,5-6,19H,1,4H2 |
| InChIKey | SOGSHJUNMITPPO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|