C17H23NO3 — CID 89024276
9-benzyl-1,4-dioxa-9-azaspiro[4.7]dodecane-7-carbaldehyde (PubChem CID 89024276) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 9-benzyl-1,4-dioxa-9-azaspiro[4.7]dodecane-7-carbaldehyde.
| Compound Name | 9-benzyl-1,4-dioxa-9-azaspiro[4.7]dodecane-7-carbaldehyde |
|---|---|
| PubChem CID | 89024276 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 9-benzyl-1,4-dioxa-9-azaspiro[4.7]dodecane-7-carbaldehyde |
| SMILES | O=CC1CN(Cc2ccccc2)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C17H23NO3/c19-14-16-11-17(20-9-10-21-17)7-4-8-18(13-16)12-15-5-2-1-3-6-15/h1-3,5-6,14,16H,4,7-13H2 |
| InChIKey | PJFVMUUYQQCXKQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|