C18H21NO7S — CID 89027821
(4aS,7aR)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-5-sulfonic acid (PubChem CID 89027821) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is (4aS,7aR)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-5-sulfonic acid.
| Compound Name | (4aS,7aR)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-5-sulfonic acid |
|---|---|
| PubChem CID | 89027821 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (4aS,7aR)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-5-sulfonic acid |
| SMILES | CN1CCC23c4c5ccc(CO)c4O[C@H]2C(=O)CC(S(=O)(=O)O)[C@@]3(O)C1C5 |
| InChI | InChI=1S/C18H21NO7S/c1-19-5-4-17-14-9-2-3-10(8-20)15(14)26-16(17)11(21)7-13(27(23,24)25)18(17,22)12(19)6-9/h2-3,12-13,16,20,22H,4-8H2,1H3,(H,23,24,25)/t12?,13?,16-,17?,18-/m0/s1 |
| InChIKey | AMJHFTJTKFOAKB-LRRLQRDXSA-N |
| XLogP | -0.60 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|