C21H25F2N9O3S — CID 89027914
1-[2-[N-ethyl-2,6-difluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]anilino]ethylamino]-1-methyl-3-(1,3-thiazol-2-yl)urea (PubChem CID 89027914) has the molecular formula C21H25F2N9O3S and a molecular weight of 521.55 g/mol. Its IUPAC name is 1-[2-[N-ethyl-2,6-difluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]anilino]ethylamino]-1-methyl-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-[N-ethyl-2,6-difluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]anilino]ethylamino]-1-methyl-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 89027914 |
| Molecular Formula | C21H25F2N9O3S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-[2-[N-ethyl-2,6-difluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]anilino]ethylamino]-1-methyl-3-(1,3-thiazol-2-yl)urea |
| SMILES | CCN(CCNN(C)C(=O)Nc1nccs1)c1c(F)cc(N2C[C@H](Cn3ccnn3)OC2=O)cc1F |
| InChI | InChI=1S/C21H25F2N9O3S/c1-3-30(7-5-26-29(2)20(33)27-19-24-6-9-36-19)18-16(22)10-14(11-17(18)23)32-13-15(35-21(32)34)12-31-8-4-25-28-31/h4,6,8-11,15,26H,3,5,7,12-13H2,1-2H3,(H,24,27,33)/t15-/m0/s1 |
| InChIKey | LXKLAOAGFQIFNQ-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|