C20H24N4O2S — CID 89030320
1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3-[2-[3-(1-sulfanylpropan-2-yl)phenyl]propan-2-yl]urea (PubChem CID 89030320) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3-[2-[3-(1-sulfanylpropan-2-yl)phenyl]propan-2-yl]urea.
| Compound Name | 1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3-[2-[3-(1-sulfanylpropan-2-yl)phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 89030320 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-3-[2-[3-(1-sulfanylpropan-2-yl)phenyl]propan-2-yl]urea |
| SMILES | CC(CS)c1cccc(C(C)(C)NC(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C20H24N4O2S/c1-12(11-27)13-5-4-6-14(9-13)20(2,3)24-19(26)21-15-7-8-16-17(10-15)23-18(25)22-16/h4-10,12,27H,11H2,1-3H3,(H2,21,24,26)(H2,22,23,25) |
| InChIKey | IIJBYBHKKFDIDQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|