About butyl 2-cyanoethanimidate
butyl 2-cyanoethanimidate (PubChem CID 89030633) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is butyl 2-cyanoethanimidate.
Molecular Properties
| Compound Name | butyl 2-cyanoethanimidate |
| PubChem CID | 89030633 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | butyl 2-cyanoethanimidate |
| SMILES | [H]/N=C(\CC#N)OCCCC |
| InChI | InChI=1S/C7H12N2O/c1-2-3-6-10-7(9)4-5-8/h9H,2-4,6H2,1H3/b9-7+ |
| InChIKey | MHWTZZCHIADADU-VQHVLOKHSA-N |
| XLogP | 1.69 |
| TPSA | 56.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-cyanoethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-cyanoethanimidate?
The IUPAC name of butyl 2-cyanoethanimidate (CID 89030633) is butyl 2-cyanoethanimidate.
What is the SMILES notation for butyl 2-cyanoethanimidate?
The canonical SMILES for butyl 2-cyanoethanimidate is [H]/N=C(\CC#N)OCCCC.
What is the InChIKey of butyl 2-cyanoethanimidate?
The InChIKey is MHWTZZCHIADADU-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H12N2O/c1-2-3-6-10-7(9)4-5-8/h9H,2-4,6H2,1H3/b9-7+.
What are the key properties of butyl 2-cyanoethanimidate?
butyl 2-cyanoethanimidate has a molecular weight of 140.19 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-cyanoethanimidate is sourced from PubChem (CID 89030633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).