About butyl 3-butoxypropanimidate;hydrobromide
butyl 3-butoxypropanimidate;hydrobromide (PubChem CID 162138066) has the molecular formula C11H24BrNO2
and a molecular weight of 282.22 g/mol. Its IUPAC name is butyl 3-butoxypropanimidate;hydrobromide.
Molecular Properties
| Compound Name | butyl 3-butoxypropanimidate;hydrobromide |
| PubChem CID | 162138066 |
| Molecular Formula | C11H24BrNO2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | butyl 3-butoxypropanimidate;hydrobromide |
| SMILES | Br.[H]/N=C(/CCOCCCC)OCCCC |
| InChI | InChI=1S/C11H23NO2.BrH/c1-3-5-8-13-10-7-11(12)14-9-6-4-2;/h12H,3-10H2,1-2H3;1H/b12-11-; |
| InChIKey | ZJOAODAIAIEYGN-AFEZEDKISA-N |
| XLogP | 3.57 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-butoxypropanimidate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-butoxypropanimidate;hydrobromide?
The IUPAC name of butyl 3-butoxypropanimidate;hydrobromide (CID 162138066) is butyl 3-butoxypropanimidate;hydrobromide.
What is the SMILES notation for butyl 3-butoxypropanimidate;hydrobromide?
The canonical SMILES for butyl 3-butoxypropanimidate;hydrobromide is Br.[H]/N=C(/CCOCCCC)OCCCC.
What is the InChIKey of butyl 3-butoxypropanimidate;hydrobromide?
The InChIKey is ZJOAODAIAIEYGN-AFEZEDKISA-N. The full InChI is InChI=1S/C11H23NO2.BrH/c1-3-5-8-13-10-7-11(12)14-9-6-4-2;/h12H,3-10H2,1-2H3;1H/b12-11-;.
What are the key properties of butyl 3-butoxypropanimidate;hydrobromide?
butyl 3-butoxypropanimidate;hydrobromide has a molecular weight of 282.22 g/mol, XLogP of 3.57, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-butoxypropanimidate;hydrobromide is sourced from PubChem (CID 162138066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).