C13H28BrN — CID 89032081
5-bromo-N-tert-butyl-3,5-dimethylheptan-3-amine (PubChem CID 89032081) has the molecular formula C13H28BrN and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-bromo-N-tert-butyl-3,5-dimethylheptan-3-amine.
| Compound Name | 5-bromo-N-tert-butyl-3,5-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 89032081 |
| Molecular Formula | C13H28BrN |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 5-bromo-N-tert-butyl-3,5-dimethylheptan-3-amine |
| SMILES | CCC(C)(Br)CC(C)(CC)NC(C)(C)C |
| InChI | InChI=1S/C13H28BrN/c1-8-12(6,14)10-13(7,9-2)15-11(3,4)5/h15H,8-10H2,1-7H3 |
| InChIKey | YHBPPSFLWWTQPN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|