C8H16N2O2S — CID 89034903
(2Z,4Z)-4-(2-aminoethyl)hexa-2,4-diene-1-sulfonamide (PubChem CID 89034903) has the molecular formula C8H16N2O2S and a molecular weight of 204.30 g/mol. Its IUPAC name is (2Z,4Z)-4-(2-aminoethyl)hexa-2,4-diene-1-sulfonamide.
| Compound Name | (2Z,4Z)-4-(2-aminoethyl)hexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 89034903 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2Z,4Z)-4-(2-aminoethyl)hexa-2,4-diene-1-sulfonamide |
| SMILES | C/C=C(\C=C/CS(N)(=O)=O)CCN |
| InChI | InChI=1S/C8H16N2O2S/c1-2-8(5-6-9)4-3-7-13(10,11)12/h2-4H,5-7,9H2,1H3,(H2,10,11,12)/b4-3-,8-2+ |
| InChIKey | GINYNSFFDNICKI-MARJDINYSA-N |
| XLogP | 0.13 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|