C18H17NO5S — CID 89034992
9H-fluoren-9-ylmethyl 2,2-dioxooxathiazinane-3-carboxylate (PubChem CID 89034992) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2,2-dioxooxathiazinane-3-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2,2-dioxooxathiazinane-3-carboxylate |
|---|---|
| PubChem CID | 89034992 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2,2-dioxooxathiazinane-3-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCCOS1(=O)=O |
| InChI | InChI=1S/C18H17NO5S/c20-18(19-10-5-11-24-25(19,21)22)23-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17H,5,10-12H2 |
| InChIKey | CXYPKORBMBGBOY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |