C16H11F7N4O2 — CID 89039157
1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(2,2,2-trifluoroacetyl)amino]urea (PubChem CID 89039157) has the molecular formula C16H11F7N4O2 and a molecular weight of 424.28 g/mol. Its IUPAC name is 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(2,2,2-trifluoroacetyl)amino]urea.
| Compound Name | 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(2,2,2-trifluoroacetyl)amino]urea |
|---|---|
| PubChem CID | 89039157 |
| Molecular Formula | C16H11F7N4O2 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(2,2,2-trifluoroacetyl)amino]urea |
| SMILES | O=C(NCc1ccc(-c2cccc(F)c2C(F)(F)F)cn1)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H11F7N4O2/c17-11-3-1-2-10(12(11)15(18,19)20)8-4-5-9(24-6-8)7-25-14(29)27-26-13(28)16(21,22)23/h1-6H,7H2,(H,26,28)(H2,25,27,29) |
| InChIKey | YWVZYGZXQLUZPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|