C19H15F4N5O4 — CID 70858834
1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]urea (PubChem CID 70858834) has the molecular formula C19H15F4N5O4 and a molecular weight of 453.35 g/mol. Its IUPAC name is 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]urea.
| Compound Name | 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 70858834 |
| Molecular Formula | C19H15F4N5O4 |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1-[[5-[3-fluoro-2-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]-3-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]urea |
| SMILES | COc1cc(C(=O)NNC(=O)NCc2ccc(-c3cccc(F)c3C(F)(F)F)cn2)on1 |
| InChI | InChI=1S/C19H15F4N5O4/c1-31-15-7-14(32-28-15)17(29)26-27-18(30)25-9-11-6-5-10(8-24-11)12-3-2-4-13(20)16(12)19(21,22)23/h2-8H,9H2,1H3,(H,26,29)(H2,25,27,30) |
| InChIKey | FYHXKVATGPYAQC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|