C19H13N5OS2 — CID 169223231
1-[[5-(1,3-benzothiazol-7-yl)-2-pyridinyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 169223231) has the molecular formula C19H13N5OS2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-[[5-(1,3-benzothiazol-7-yl)-2-pyridinyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[[5-(1,3-benzothiazol-7-yl)-2-pyridinyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 169223231 |
| Molecular Formula | C19H13N5OS2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 1-[[5-(1,3-benzothiazol-7-yl)-2-pyridinyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NCc2ccc(-c3cccc4ncsc34)cn2)cs1 |
| InChI | InChI=1S/C19H13N5OS2/c1-2-17-23-16(10-26-17)24-19(25)21-9-13-7-6-12(8-20-13)14-4-3-5-15-18(14)27-11-22-15/h1,3-8,10-11H,9H2,(H2,21,24,25) |
| InChIKey | HTVBVFSJUJJDTF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|