C24H19N5O3S — CID 175604052
ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinolin-8-ylphenyl)carbamate (PubChem CID 175604052) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinolin-8-ylphenyl)carbamate.
| Compound Name | ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinolin-8-ylphenyl)carbamate |
|---|---|
| PubChem CID | 175604052 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinolin-8-ylphenyl)carbamate |
| SMILES | C#Cc1nc(NC(=O)NN(C(=O)OCC)c2ccc(-c3cccc4cccnc34)cc2)cs1 |
| InChI | InChI=1S/C24H19N5O3S/c1-3-21-26-20(15-33-21)27-23(30)28-29(24(31)32-4-2)18-12-10-16(11-13-18)19-9-5-7-17-8-6-14-25-22(17)19/h1,5-15H,4H2,2H3,(H2,27,28,30) |
| InChIKey | ZYWJUKUEJOQMFF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|