C23H19N5O2S — CID 174219626
1-[1-[4-[2-(1-cyanocyclopropyl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 174219626) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-[1-[4-[2-(1-cyanocyclopropyl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[1-[4-[2-(1-cyanocyclopropyl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 174219626 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[1-[4-[2-(1-cyanocyclopropyl)-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-c3cccnc3C3(C#N)CC3)cc2)cs1 |
| InChI | InChI=1S/C23H19N5O2S/c1-2-20-27-19(13-31-20)28-22(30)26-18(12-29)16-7-5-15(6-8-16)17-4-3-11-25-21(17)23(14-24)9-10-23/h1,3-8,11,13,18,29H,9-10,12H2,(H2,26,28,30) |
| InChIKey | IHOJIGLAJOFEHZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|