C19H16N4O3S — CID 174219610
1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(2-oxo-1-pyridinyl)phenyl]ethyl]urea (PubChem CID 174219610) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(2-oxo-1-pyridinyl)phenyl]ethyl]urea.
| Compound Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(2-oxo-1-pyridinyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 174219610 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(2-oxo-1-pyridinyl)phenyl]ethyl]urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-n3ccccc3=O)cc2)cs1 |
| InChI | InChI=1S/C19H16N4O3S/c1-2-17-21-16(12-27-17)22-19(26)20-15(11-24)13-6-8-14(9-7-13)23-10-4-3-5-18(23)25/h1,3-10,12,15,24H,11H2,(H2,20,22,26) |
| InChIKey | YSFNDZUNWBYVMZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|