C24H19N5O3S — CID 171401022
[(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinolin-8-ylphenyl)ethyl] carbamate (PubChem CID 171401022) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinolin-8-ylphenyl)ethyl] carbamate.
| Compound Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinolin-8-ylphenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 171401022 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinolin-8-ylphenyl)ethyl] carbamate |
| SMILES | C#Cc1nc(NC(=O)N[C@@H](COC(N)=O)c2ccc(-c3cccc4cccnc34)cc2)cs1 |
| InChI | InChI=1S/C24H19N5O3S/c1-2-21-28-20(14-33-21)29-24(31)27-19(13-32-23(25)30)16-10-8-15(9-11-16)18-7-3-5-17-6-4-12-26-22(17)18/h1,3-12,14,19H,13H2,(H2,25,30)(H2,27,29,31)/t19-/m0/s1 |
| InChIKey | SJABYGDXOYMNPQ-IBGZPJMESA-N |
| XLogP | 4.30 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|