C23H19N5O4S — CID 167101369
1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[2-(2-hydroxyethoxy)-4-oxo-3H-quinazolin-5-yl]phenyl]methyl]urea (PubChem CID 167101369) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[2-(2-hydroxyethoxy)-4-oxo-3H-quinazolin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[2-(2-hydroxyethoxy)-4-oxo-3H-quinazolin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 167101369 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[2-(2-hydroxyethoxy)-4-oxo-3H-quinazolin-5-yl]phenyl]methyl]urea |
| SMILES | C#Cc1nc(NC(=O)NCc2ccc(-c3cccc4nc(OCCO)[nH]c(=O)c34)cc2)cs1 |
| InChI | InChI=1S/C23H19N5O4S/c1-2-19-26-18(13-33-19)27-22(31)24-12-14-6-8-15(9-7-14)16-4-3-5-17-20(16)21(30)28-23(25-17)32-11-10-29/h1,3-9,13,29H,10-12H2,(H2,24,27,31)(H,25,28,30) |
| InChIKey | SIBHNLGZTDGDGI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|