C18H19N5O2S — CID 167101332
1-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 167101332) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167101332 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | C#Cc1nc(NC(=O)NCc2ccc(N3CCCC3C(N)=O)cc2)cs1 |
| InChI | InChI=1S/C18H19N5O2S/c1-2-16-21-15(11-26-16)22-18(25)20-10-12-5-7-13(8-6-12)23-9-3-4-14(23)17(19)24/h1,5-8,11,14H,3-4,9-10H2,(H2,19,24)(H2,20,22,25) |
| InChIKey | NUWUGAKDIFTLQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|