C24H18F2N6OS — CID 167101818
1-[[4-[2-(3,3-difluoroazetidin-1-yl)quinazolin-5-yl]phenyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 167101818) has the molecular formula C24H18F2N6OS and a molecular weight of 476.51 g/mol. Its IUPAC name is 1-[[4-[2-(3,3-difluoroazetidin-1-yl)quinazolin-5-yl]phenyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[[4-[2-(3,3-difluoroazetidin-1-yl)quinazolin-5-yl]phenyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 167101818 |
| Molecular Formula | C24H18F2N6OS |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-[[4-[2-(3,3-difluoroazetidin-1-yl)quinazolin-5-yl]phenyl]methyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NCc2ccc(-c3cccc4nc(N5CC(F)(F)C5)ncc34)cc2)cs1 |
| InChI | InChI=1S/C24H18F2N6OS/c1-2-21-30-20(12-34-21)31-23(33)28-10-15-6-8-16(9-7-15)17-4-3-5-19-18(17)11-27-22(29-19)32-13-24(25,26)14-32/h1,3-9,11-12H,10,13-14H2,(H2,28,31,33) |
| InChIKey | HMMGIZIOOPCKDG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|