C22H17N5O2S2 — CID 167101832
7-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]-N-methyl-1,3-benzothiazole-6-carboxamide (PubChem CID 167101832) has the molecular formula C22H17N5O2S2 and a molecular weight of 447.55 g/mol. Its IUPAC name is 7-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]-N-methyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 7-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]-N-methyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 167101832 |
| Molecular Formula | C22H17N5O2S2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 7-[4-[[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]methyl]phenyl]-N-methyl-1,3-benzothiazole-6-carboxamide |
| SMILES | C#Cc1nc(NC(=O)NCc2ccc(-c3c(C(=O)NC)ccc4ncsc34)cc2)cs1 |
| InChI | InChI=1S/C22H17N5O2S2/c1-3-18-26-17(11-30-18)27-22(29)24-10-13-4-6-14(7-5-13)19-15(21(28)23-2)8-9-16-20(19)31-12-25-16/h1,4-9,11-12H,10H2,2H3,(H,23,28)(H2,24,27,29) |
| InChIKey | FZSAZWSEIYFBKC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|