C23H18N6O3S — CID 175603969
ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinoxalin-5-ylphenyl)carbamate (PubChem CID 175603969) has the molecular formula C23H18N6O3S and a molecular weight of 458.50 g/mol. Its IUPAC name is ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinoxalin-5-ylphenyl)carbamate.
| Compound Name | ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinoxalin-5-ylphenyl)carbamate |
|---|---|
| PubChem CID | 175603969 |
| Molecular Formula | C23H18N6O3S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | ethyl N-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-N-(4-quinoxalin-5-ylphenyl)carbamate |
| SMILES | C#Cc1nc(NC(=O)NN(C(=O)OCC)c2ccc(-c3cccc4nccnc34)cc2)cs1 |
| InChI | InChI=1S/C23H18N6O3S/c1-3-20-26-19(14-33-20)27-22(30)28-29(23(31)32-4-2)16-10-8-15(9-11-16)17-6-5-7-18-21(17)25-13-12-24-18/h1,5-14H,4H2,2H3,(H2,27,28,30) |
| InChIKey | LHTPLAROLSICJC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|