C23H18N6O3S — CID 171400983
[(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinazolin-8-ylphenyl)ethyl] carbamate (PubChem CID 171400983) has the molecular formula C23H18N6O3S and a molecular weight of 458.50 g/mol. Its IUPAC name is [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinazolin-8-ylphenyl)ethyl] carbamate.
| Compound Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinazolin-8-ylphenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 171400983 |
| Molecular Formula | C23H18N6O3S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [(2R)-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]-2-(4-quinazolin-8-ylphenyl)ethyl] carbamate |
| SMILES | C#Cc1nc(NC(=O)N[C@@H](COC(N)=O)c2ccc(-c3cccc4cncnc34)cc2)cs1 |
| InChI | InChI=1S/C23H18N6O3S/c1-2-20-28-19(12-33-20)29-23(31)27-18(11-32-22(24)30)15-8-6-14(7-9-15)17-5-3-4-16-10-25-13-26-21(16)17/h1,3-10,12-13,18H,11H2,(H2,24,30)(H2,27,29,31)/t18-/m0/s1 |
| InChIKey | HOPORTRJKSQSFV-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|