C23H19N5O3S2 — CID 171400986
[(2R)-2-[4-(1,3-benzothiazol-7-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] N-methylcarbamate (PubChem CID 171400986) has the molecular formula C23H19N5O3S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is [(2R)-2-[4-(1,3-benzothiazol-7-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] N-methylcarbamate.
| Compound Name | [(2R)-2-[4-(1,3-benzothiazol-7-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] N-methylcarbamate |
|---|---|
| PubChem CID | 171400986 |
| Molecular Formula | C23H19N5O3S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [(2R)-2-[4-(1,3-benzothiazol-7-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] N-methylcarbamate |
| SMILES | C#Cc1nc(NC(=O)N[C@@H](COC(=O)NC)c2ccc(-c3cccc4ncsc34)cc2)cs1 |
| InChI | InChI=1S/C23H19N5O3S2/c1-3-20-27-19(12-32-20)28-22(29)26-18(11-31-23(30)24-2)15-9-7-14(8-10-15)16-5-4-6-17-21(16)33-13-25-17/h1,4-10,12-13,18H,11H2,2H3,(H,24,30)(H2,26,28,29)/t18-/m0/s1 |
| InChIKey | ZTZUFSRLULKKMF-SFHVURJKSA-N |
| XLogP | 4.62 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|