C22H16ClN5O3S — CID 174219559
1-[1-[3-chloro-4-(4-oxo-3H-quinazolin-5-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 174219559) has the molecular formula C22H16ClN5O3S and a molecular weight of 465.92 g/mol. Its IUPAC name is 1-[1-[3-chloro-4-(4-oxo-3H-quinazolin-5-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[1-[3-chloro-4-(4-oxo-3H-quinazolin-5-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 174219559 |
| Molecular Formula | C22H16ClN5O3S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 1-[1-[3-chloro-4-(4-oxo-3H-quinazolin-5-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-c3cccc4nc[nH]c(=O)c34)c(Cl)c2)cs1 |
| InChI | InChI=1S/C22H16ClN5O3S/c1-2-19-27-18(10-32-19)28-22(31)26-17(9-29)12-6-7-13(15(23)8-12)14-4-3-5-16-20(14)21(30)25-11-24-16/h1,3-8,10-11,17,29H,9H2,(H,24,25,30)(H2,26,28,31) |
| InChIKey | BZVGCTWHSIJWLB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|