C24H20N4OS2 — CID 167101825
4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperidine-1-carboxamide (PubChem CID 167101825) has the molecular formula C24H20N4OS2 and a molecular weight of 444.59 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperidine-1-carboxamide.
| Compound Name | 4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167101825 |
| Molecular Formula | C24H20N4OS2 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperidine-1-carboxamide |
| SMILES | C#Cc1nc(NC(=O)N2CCC(c3ccc(-c4cccc5ncsc45)cc3)CC2)cs1 |
| InChI | InChI=1S/C24H20N4OS2/c1-2-22-26-21(14-30-22)27-24(29)28-12-10-17(11-13-28)16-6-8-18(9-7-16)19-4-3-5-20-23(19)31-15-25-20/h1,3-9,14-15,17H,10-13H2,(H,27,29) |
| InChIKey | KPJNYEUECRQBAO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|