C23H19N5OS — CID 167101408
4-[4-(2-cyanophenyl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperazine-1-carboxamide (PubChem CID 167101408) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is 4-[4-(2-cyanophenyl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperazine-1-carboxamide.
| Compound Name | 4-[4-(2-cyanophenyl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167101408 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[4-(2-cyanophenyl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)piperazine-1-carboxamide |
| SMILES | C#Cc1nc(NC(=O)N2CCN(c3ccc(-c4ccccc4C#N)cc3)CC2)cs1 |
| InChI | InChI=1S/C23H19N5OS/c1-2-22-25-21(16-30-22)26-23(29)28-13-11-27(12-14-28)19-9-7-17(8-10-19)20-6-4-3-5-18(20)15-24/h1,3-10,16H,11-14H2,(H,26,29) |
| InChIKey | HARMSGMVCFJIIS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|