C24H21N5O2S2 — CID 167101757
(3S)-4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)-3-(hydroxymethyl)piperazine-1-carboxamide (PubChem CID 167101757) has the molecular formula C24H21N5O2S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is (3S)-4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)-3-(hydroxymethyl)piperazine-1-carboxamide.
| Compound Name | (3S)-4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)-3-(hydroxymethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167101757 |
| Molecular Formula | C24H21N5O2S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (3S)-4-[4-(1,3-benzothiazol-7-yl)phenyl]-N-(2-ethynyl-1,3-thiazol-4-yl)-3-(hydroxymethyl)piperazine-1-carboxamide |
| SMILES | C#Cc1nc(NC(=O)N2CCN(c3ccc(-c4cccc5ncsc45)cc3)[C@H](CO)C2)cs1 |
| InChI | InChI=1S/C24H21N5O2S2/c1-2-22-26-21(14-32-22)27-24(31)28-10-11-29(18(12-28)13-30)17-8-6-16(7-9-17)19-4-3-5-20-23(19)33-15-25-20/h1,3-9,14-15,18,30H,10-13H2,(H,27,31)/t18-/m0/s1 |
| InChIKey | NSLCKLQTWLJKQG-SFHVURJKSA-N |
| XLogP | 4.12 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|