C26H27N5O2S — CID 169223172
N-(2-ethynyl-1,3-thiazol-4-yl)-4-[4-[3-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]phenyl]piperazine-1-carboxamide (PubChem CID 169223172) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-(2-ethynyl-1,3-thiazol-4-yl)-4-[4-[3-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2-ethynyl-1,3-thiazol-4-yl)-4-[4-[3-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 169223172 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-(2-ethynyl-1,3-thiazol-4-yl)-4-[4-[3-[(3S)-3-hydroxypyrrolidin-1-yl]phenyl]phenyl]piperazine-1-carboxamide |
| SMILES | C#Cc1nc(NC(=O)N2CCN(c3ccc(-c4cccc(N5CC[C@H](O)C5)c4)cc3)CC2)cs1 |
| InChI | InChI=1S/C26H27N5O2S/c1-2-25-27-24(18-34-25)28-26(33)30-14-12-29(13-15-30)21-8-6-19(7-9-21)20-4-3-5-22(16-20)31-11-10-23(32)17-31/h1,3-9,16,18,23,32H,10-15,17H2,(H,28,33)/t23-/m0/s1 |
| InChIKey | XJBHNLXYCGBKHP-QHCPKHFHSA-N |
| XLogP | 3.72 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|