C15H10N4OS — CID 174219570
(E)-2-amino-3-(2-cyanophenyl)-N-(2-ethynyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 174219570) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is (E)-2-amino-3-(2-cyanophenyl)-N-(2-ethynyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-2-amino-3-(2-cyanophenyl)-N-(2-ethynyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174219570 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (E)-2-amino-3-(2-cyanophenyl)-N-(2-ethynyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | C#Cc1nc(NC(=O)/C(N)=C\c2ccccc2C#N)cs1 |
| InChI | InChI=1S/C15H10N4OS/c1-2-14-18-13(9-21-14)19-15(20)12(17)7-10-5-3-4-6-11(10)8-16/h1,3-7,9H,17H2,(H,19,20)/b12-7+ |
| InChIKey | QBNJJGHDNICUST-KPKJPENVSA-N |
| XLogP | 1.93 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|